C13H7F3N4S2 — CID 170949820
7-(1,3-thiazol-5-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile (PubChem CID 170949820) has the molecular formula C13H7F3N4S2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 7-(1,3-thiazol-5-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile.
| Compound Name | 7-(1,3-thiazol-5-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 170949820 |
| Molecular Formula | C13H7F3N4S2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 7-(1,3-thiazol-5-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2c(NSc3cncs3)ccc(C(F)(F)F)c12 |
| InChI | InChI=1S/C13H7F3N4S2/c14-13(15,16)8-1-2-9(20-22-10-5-18-6-21-10)12-11(8)7(3-17)4-19-12/h1-2,4-6,19-20H |
| InChIKey | HOIPVRFDDSCRBK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|