About 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile
7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile (PubChem CID 170949380) has the molecular formula C13H7F3N4S2
and a molecular weight of 340.36 g/mol. Its IUPAC name is 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile.
Molecular Properties
| Compound Name | 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile |
| PubChem CID | 170949380 |
| Molecular Formula | C13H7F3N4S2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2c(NSc3cnsc3)ccc(C(F)(F)F)c12 |
| InChI | InChI=1S/C13H7F3N4S2/c14-13(15,16)9-1-2-10(20-22-8-5-19-21-6-8)12-11(9)7(3-17)4-18-12/h1-2,4-6,18,20H |
| InChIKey | MNJKESQGKUQPAU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile?
The IUPAC name of 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile (CID 170949380) is 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile.
What is the SMILES notation for 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile?
The canonical SMILES for 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile is N#Cc1c[nH]c2c(NSc3cnsc3)ccc(C(F)(F)F)c12.
What is the InChIKey of 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile?
The InChIKey is MNJKESQGKUQPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3N4S2/c14-13(15,16)9-1-2-10(20-22-8-5-19-21-6-8)12-11(9)7(3-17)4-18-12/h1-2,4-6,18,20H.
What are the key properties of 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile?
7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile has a molecular weight of 340.36 g/mol, XLogP of 4.63, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,2-thiazol-4-ylsulfanylamino)-4-(trifluoromethyl)-1H-indole-3-carbonitrile is sourced from PubChem (CID 170949380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).