C18H17N3S — CID 142616692
7-[(4-ethylphenyl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile (PubChem CID 142616692) has the molecular formula C18H17N3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 7-[(4-ethylphenyl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile.
| Compound Name | 7-[(4-ethylphenyl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 142616692 |
| Molecular Formula | C18H17N3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 7-[(4-ethylphenyl)sulfanylamino]-4-methyl-1H-indole-3-carbonitrile |
| SMILES | CCc1ccc(SNc2ccc(C)c3c(C#N)c[nH]c23)cc1 |
| InChI | InChI=1S/C18H17N3S/c1-3-13-5-7-15(8-6-13)22-21-16-9-4-12(2)17-14(10-19)11-20-18(16)17/h4-9,11,20-21H,3H2,1-2H3 |
| InChIKey | KHZOFBAFDVGQRK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|