C19H18N4OS — CID 153329681
N-[[4-[(3-cyano-4-methyl-1H-indol-7-yl)amino]sulfanylphenyl]methyl]acetamide (PubChem CID 153329681) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is N-[[4-[(3-cyano-4-methyl-1H-indol-7-yl)amino]sulfanylphenyl]methyl]acetamide.
| Compound Name | N-[[4-[(3-cyano-4-methyl-1H-indol-7-yl)amino]sulfanylphenyl]methyl]acetamide |
|---|---|
| PubChem CID | 153329681 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-[[4-[(3-cyano-4-methyl-1H-indol-7-yl)amino]sulfanylphenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(SNc2ccc(C)c3c(C#N)c[nH]c23)cc1 |
| InChI | InChI=1S/C19H18N4OS/c1-12-3-8-17(19-18(12)15(9-20)11-22-19)23-25-16-6-4-14(5-7-16)10-21-13(2)24/h3-8,11,22-23H,10H2,1-2H3,(H,21,24) |
| InChIKey | SBJXHOZVXRIQCY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|