C12H7ClN4OS — CID 170949623
4-chloro-7-(1,3-oxazol-5-ylsulfanylamino)-1H-indole-3-carbonitrile (PubChem CID 170949623) has the molecular formula C12H7ClN4OS and a molecular weight of 290.74 g/mol. Its IUPAC name is 4-chloro-7-(1,3-oxazol-5-ylsulfanylamino)-1H-indole-3-carbonitrile.
| Compound Name | 4-chloro-7-(1,3-oxazol-5-ylsulfanylamino)-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 170949623 |
| Molecular Formula | C12H7ClN4OS |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 4-chloro-7-(1,3-oxazol-5-ylsulfanylamino)-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c[nH]c2c(NSc3cnco3)ccc(Cl)c12 |
| InChI | InChI=1S/C12H7ClN4OS/c13-8-1-2-9(17-19-10-5-15-6-18-10)12-11(8)7(3-14)4-16-12/h1-2,4-6,16-17H |
| InChIKey | MIWJUCSNOPYUPX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 77.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|