C23H22N2O — CID 177229046
1-pyrrol-1-yl-3,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide (PubChem CID 177229046) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-pyrrol-1-yl-3,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide.
| Compound Name | 1-pyrrol-1-yl-3,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229046 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-pyrrol-1-yl-3,4,4a,5,5a,6-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(n2cccc2)C2=CC3=Cc4ccccc4CC3CC2CC1 |
| InChI | InChI=1S/C23H22N2O/c24-23(26)20-8-7-17-13-18-11-15-5-1-2-6-16(15)12-19(18)14-21(17)22(20)25-9-3-4-10-25/h1-6,9-10,12,14,17-18H,7-8,11,13H2,(H2,24,26) |
| InChIKey | RRBKEFQRDSFUAC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |