C19H19NO — CID 69129815
1,2,3,4,12,12a-hexahydrotetracene-2-carboxamide (PubChem CID 69129815) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 1,2,3,4,12,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 1,2,3,4,12,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 69129815 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1,2,3,4,12,12a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1CCC2=Cc3cc4ccccc4cc3CC2C1 |
| InChI | InChI=1S/C19H19NO/c20-19(21)15-6-5-14-9-17-7-12-3-1-2-4-13(12)8-18(17)11-16(14)10-15/h1-4,7-9,15-16H,5-6,10-11H2,(H2,20,21) |
| InChIKey | HCLFWWRFVXIQHJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |