C19H18O2 — CID 146453645
1,2,3,4,4a,5-hexahydrotetracene-1-carboxylic acid (PubChem CID 146453645) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrotetracene-1-carboxylic acid.
| Compound Name | 1,2,3,4,4a,5-hexahydrotetracene-1-carboxylic acid |
|---|---|
| PubChem CID | 146453645 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrotetracene-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC2Cc3cc4ccccc4cc3C=C21 |
| InChI | InChI=1S/C19H18O2/c20-19(21)17-7-3-6-14-10-15-8-12-4-1-2-5-13(12)9-16(15)11-18(14)17/h1-2,4-5,8-9,11,14,17H,3,6-7,10H2,(H,20,21) |
| InChIKey | TZVCBPFBFSWAJG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |