C26H25N3O9 — CID 177229096
(4Z,12aS)-3,10,11,12a-tetrahydroxy-4-methoxyimino-1,12-dioxo-7-(3-propan-2-yl-1,2-oxazol-5-yl)-4a,5,5a,6-tetrahydrotetracene-2-carboxamide (PubChem CID 177229096) has the molecular formula C26H25N3O9 and a molecular weight of 523.50 g/mol. Its IUPAC name is (4Z,12aS)-3,10,11,12a-tetrahydroxy-4-methoxyimino-1,12-dioxo-7-(3-propan-2-yl-1,2-oxazol-5-yl)-4a,5,5a,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4Z,12aS)-3,10,11,12a-tetrahydroxy-4-methoxyimino-1,12-dioxo-7-(3-propan-2-yl-1,2-oxazol-5-yl)-4a,5,5a,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229096 |
| Molecular Formula | C26H25N3O9 |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | (4Z,12aS)-3,10,11,12a-tetrahydroxy-4-methoxyimino-1,12-dioxo-7-(3-propan-2-yl-1,2-oxazol-5-yl)-4a,5,5a,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CO/N=C1\C(O)=C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5cc(C(C)C)no5)c4CC3CC12 |
| InChI | InChI=1S/C26H25N3O9/c1-9(2)14-8-16(38-28-14)11-4-5-15(30)18-12(11)6-10-7-13-20(29-37-3)22(32)19(25(27)35)24(34)26(13,36)23(33)17(10)21(18)31/h4-5,8-10,13,30-32,36H,6-7H2,1-3H3,(H2,27,35)/b29-20-/t10?,13?,26-/m0/s1 |
| InChIKey | DIQGSHNWYWOUKX-VZXNUBLJSA-N |
| XLogP | 1.81 |
| TPSA | 205.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|