C26H25N3O10 — CID 177228949
(4Z,4aS,5aR,12aS)-3,10,11,12a-tetrahydroxy-7-[4-(2-hydroxypropan-2-yl)-1,3-oxazol-2-yl]-4-methoxyimino-1,12-dioxo-4a,5,5a,6-tetrahydrotetracene-2-carboxamide (PubChem CID 177228949) has the molecular formula C26H25N3O10 and a molecular weight of 539.50 g/mol. Its IUPAC name is (4Z,4aS,5aR,12aS)-3,10,11,12a-tetrahydroxy-7-[4-(2-hydroxypropan-2-yl)-1,3-oxazol-2-yl]-4-methoxyimino-1,12-dioxo-4a,5,5a,6-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4Z,4aS,5aR,12aS)-3,10,11,12a-tetrahydroxy-7-[4-(2-hydroxypropan-2-yl)-1,3-oxazol-2-yl]-4-methoxyimino-1,12-dioxo-4a,5,5a,6-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 177228949 |
| Molecular Formula | C26H25N3O10 |
| Molecular Weight | 539.50 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | (4Z,4aS,5aR,12aS)-3,10,11,12a-tetrahydroxy-7-[4-(2-hydroxypropan-2-yl)-1,3-oxazol-2-yl]-4-methoxyimino-1,12-dioxo-4a,5,5a,6-tetrahydrotetracene-2-carboxamide |
| SMILES | CO/N=C1\C(O)=C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5nc(C(C)(C)O)co5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H25N3O10/c1-25(2,36)14-8-39-24(28-14)10-4-5-13(30)16-11(10)6-9-7-12-18(29-38-3)20(32)17(23(27)35)22(34)26(12,37)21(33)15(9)19(16)31/h4-5,8-9,12,30-32,36-37H,6-7H2,1-3H3,(H2,27,35)/b29-18-/t9-,12-,26-/m0/s1 |
| InChIKey | NIXMKUOJCCGWOQ-TZKKKVFLSA-N |
| XLogP | 0.92 |
| TPSA | 226.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.50 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|