C24H25N5O6 — CID 177229186
(4R,4aR,5aR)-4-amino-1,10,11-trihydroxy-3,12-dioxo-7-(4-propan-2-yltriazol-1-yl)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 177229186) has the molecular formula C24H25N5O6 and a molecular weight of 479.49 g/mol. Its IUPAC name is (4R,4aR,5aR)-4-amino-1,10,11-trihydroxy-3,12-dioxo-7-(4-propan-2-yltriazol-1-yl)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aR)-4-amino-1,10,11-trihydroxy-3,12-dioxo-7-(4-propan-2-yltriazol-1-yl)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 177229186 |
| Molecular Formula | C24H25N5O6 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (4R,4aR,5aR)-4-amino-1,10,11-trihydroxy-3,12-dioxo-7-(4-propan-2-yltriazol-1-yl)-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CC(C)c1cn(-c2ccc(O)c3c2C[C@H]2C[C@@H]4C(C(=O)C2=C3O)C(O)=C(C(N)=O)C(=O)[C@@H]4N)nn1 |
| InChI | InChI=1S/C24H25N5O6/c1-8(2)12-7-29(28-27-12)13-3-4-14(30)16-10(13)5-9-6-11-17(21(32)15(9)20(16)31)22(33)18(24(26)35)23(34)19(11)25/h3-4,7-9,11,17,19,30-31,33H,5-6,25H2,1-2H3,(H2,26,35)/t9-,11+,17?,19+/m0/s1 |
| InChIKey | ASTNKCIUWQMUSM-MQCWVASXSA-N |
| XLogP | 0.95 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|