C17H13ClN4O2 — CID 177229827
N-(2-chlorophenyl)-6-(prop-2-enoylamino)imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 177229827) has the molecular formula C17H13ClN4O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is N-(2-chlorophenyl)-6-(prop-2-enoylamino)imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(2-chlorophenyl)-6-(prop-2-enoylamino)imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 177229827 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-(2-chlorophenyl)-6-(prop-2-enoylamino)imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | C=CC(=O)Nc1ccc2ncc(C(=O)Nc3ccccc3Cl)n2c1 |
| InChI | InChI=1S/C17H13ClN4O2/c1-2-16(23)20-11-7-8-15-19-9-14(22(15)10-11)17(24)21-13-6-4-3-5-12(13)18/h2-10H,1H2,(H,20,23)(H,21,24) |
| InChIKey | HDLFLBFMKSLTEO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|