C27H37ClN6O2 — CID 177230435
7-[(E)-3-[1-(7-aminoheptyl)pyrrolidin-2-yl]prop-2-enoyl]-N-(2-chlorophenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide (PubChem CID 177230435) has the molecular formula C27H37ClN6O2 and a molecular weight of 513.09 g/mol. Its IUPAC name is 7-[(E)-3-[1-(7-aminoheptyl)pyrrolidin-2-yl]prop-2-enoyl]-N-(2-chlorophenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | 7-[(E)-3-[1-(7-aminoheptyl)pyrrolidin-2-yl]prop-2-enoyl]-N-(2-chlorophenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 177230435 |
| Molecular Formula | C27H37ClN6O2 |
| Molecular Weight | 513.09 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | 7-[(E)-3-[1-(7-aminoheptyl)pyrrolidin-2-yl]prop-2-enoyl]-N-(2-chlorophenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide |
| SMILES | NCCCCCCCN1CCCC1/C=C/C(=O)N1CCn2c(C(=O)Nc3ccccc3Cl)cnc2C1 |
| InChI | InChI=1S/C27H37ClN6O2/c28-22-10-4-5-11-23(22)31-27(36)24-19-30-25-20-33(17-18-34(24)25)26(35)13-12-21-9-8-16-32(21)15-7-3-1-2-6-14-29/h4-5,10-13,19,21H,1-3,6-9,14-18,20,29H2,(H,31,36)/b13-12+ |
| InChIKey | JYUOMQKSRBBTQN-OUKQBFOZSA-N |
| XLogP | 4.06 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.09 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|