C30H44ClN5O2 — CID 177230279
(E)-1-(3-acetyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-[1-(7-aminoheptyl)pyrrolidin-2-yl]prop-2-en-1-one;1-chloro-2-ethylbenzene (PubChem CID 177230279) has the molecular formula C30H44ClN5O2 and a molecular weight of 542.17 g/mol. Its IUPAC name is (E)-1-(3-acetyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-[1-(7-aminoheptyl)pyrrolidin-2-yl]prop-2-en-1-one;1-chloro-2-ethylbenzene.
| Compound Name | (E)-1-(3-acetyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-[1-(7-aminoheptyl)pyrrolidin-2-yl]prop-2-en-1-one;1-chloro-2-ethylbenzene |
|---|---|
| PubChem CID | 177230279 |
| Molecular Formula | C30H44ClN5O2 |
| Molecular Weight | 542.17 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | (E)-1-(3-acetyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)-3-[1-(7-aminoheptyl)pyrrolidin-2-yl]prop-2-en-1-one;1-chloro-2-ethylbenzene |
| SMILES | CC(=O)c1cnc2n1CCN(C(=O)/C=C/C1CCCN1CCCCCCCN)C2.CCc1ccccc1Cl |
| InChI | InChI=1S/C22H35N5O2.C8H9Cl/c1-18(28)20-16-24-21-17-26(14-15-27(20)21)22(29)10-9-19-8-7-13-25(19)12-6-4-2-3-5-11-23;1-2-7-5-3-4-6-8(7)9/h9-10,16,19H,2-8,11-15,17,23H2,1H3;3-6H,2H2,1H3/b10-9+; |
| InChIKey | AWJABKGVLJHEHQ-RRABGKBLSA-N |
| XLogP | 5.26 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.17 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|