C25H33ClN4O2 — CID 177230369
(Z)-N-(2-chlorophenyl)-2-[2-methylidene-4-[(E)-3-(1-methylpyrrolidin-2-yl)prop-2-enoyl]piperazin-1-yl]hex-2-enamide (PubChem CID 177230369) has the molecular formula C25H33ClN4O2 and a molecular weight of 457.02 g/mol. Its IUPAC name is (Z)-N-(2-chlorophenyl)-2-[2-methylidene-4-[(E)-3-(1-methylpyrrolidin-2-yl)prop-2-enoyl]piperazin-1-yl]hex-2-enamide.
| Compound Name | (Z)-N-(2-chlorophenyl)-2-[2-methylidene-4-[(E)-3-(1-methylpyrrolidin-2-yl)prop-2-enoyl]piperazin-1-yl]hex-2-enamide |
|---|---|
| PubChem CID | 177230369 |
| Molecular Formula | C25H33ClN4O2 |
| Molecular Weight | 457.02 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | (Z)-N-(2-chlorophenyl)-2-[2-methylidene-4-[(E)-3-(1-methylpyrrolidin-2-yl)prop-2-enoyl]piperazin-1-yl]hex-2-enamide |
| SMILES | C=C1CN(C(=O)/C=C/C2CCCN2C)CCN1/C(=C\CCC)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C25H33ClN4O2/c1-4-5-12-23(25(32)27-22-11-7-6-10-21(22)26)30-17-16-29(18-19(30)2)24(31)14-13-20-9-8-15-28(20)3/h6-7,10-14,20H,2,4-5,8-9,15-18H2,1,3H3,(H,27,32)/b14-13+,23-12- |
| InChIKey | WEIAVNXFISVHCZ-DUUSJPACSA-N |
| XLogP | 4.27 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.02 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|