C13H27NO — CID 177231035
propane;(E,5S)-5-pyrrolidin-1-ylhex-3-en-2-ol (PubChem CID 177231035) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is propane;(E,5S)-5-pyrrolidin-1-ylhex-3-en-2-ol.
| Compound Name | propane;(E,5S)-5-pyrrolidin-1-ylhex-3-en-2-ol |
|---|---|
| PubChem CID | 177231035 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | propane;(E,5S)-5-pyrrolidin-1-ylhex-3-en-2-ol |
| SMILES | CC(O)/C=C/[C@H](C)N1CCCC1.CCC |
| InChI | InChI=1S/C10H19NO.C3H8/c1-9(5-6-10(2)12)11-7-3-4-8-11;1-3-2/h5-6,9-10,12H,3-4,7-8H2,1-2H3;3H2,1-2H3/b6-5+;/t9-,10?;/m0./s1 |
| InChIKey | FFNFWKOAMRMUSH-SYWPRFPASA-N |
| XLogP | 2.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|