C8H15NO — CID 146628726
1-propan-2-yl-3,6-dihydro-2H-pyridin-3-ol (PubChem CID 146628726) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 1-propan-2-yl-3,6-dihydro-2H-pyridin-3-ol.
| Compound Name | 1-propan-2-yl-3,6-dihydro-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 146628726 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 1-propan-2-yl-3,6-dihydro-2H-pyridin-3-ol |
| SMILES | CC(C)N1CC=CC(O)C1 |
| InChI | InChI=1S/C8H15NO/c1-7(2)9-5-3-4-8(10)6-9/h3-4,7-8,10H,5-6H2,1-2H3 |
| InChIKey | QUDVZLNWMNENSS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|