C7H14INO — CID 146627803
1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol iodide (PubChem CID 146627803) has the molecular formula C7H14INO and a molecular weight of 255.10 g/mol. Its IUPAC name is 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol iodide.
| Compound Name | 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol iodide |
|---|---|
| PubChem CID | 146627803 |
| Molecular Formula | C7H14INO |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 1,1-dimethyl-3,6-dihydro-2H-pyridin-1-ium-3-ol iodide |
| SMILES | C[N+]1(C)CC=CC(O)C1.[I-] |
| InChI | InChI=1S/C7H14NO.HI/c1-8(2)5-3-4-7(9)6-8;/h3-4,7,9H,5-6H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | RPYPTCYBUQCKHZ-UHFFFAOYSA-M |
| XLogP | -3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|