C9H15NO — CID 146627864
1-cyclobutyl-3,6-dihydro-2H-pyridin-3-ol (PubChem CID 146627864) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-cyclobutyl-3,6-dihydro-2H-pyridin-3-ol.
| Compound Name | 1-cyclobutyl-3,6-dihydro-2H-pyridin-3-ol |
|---|---|
| PubChem CID | 146627864 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 1-cyclobutyl-3,6-dihydro-2H-pyridin-3-ol |
| SMILES | OC1C=CCN(C2CCC2)C1 |
| InChI | InChI=1S/C9H15NO/c11-9-5-2-6-10(7-9)8-3-1-4-8/h2,5,8-9,11H,1,3-4,6-7H2 |
| InChIKey | VNPZIRLVUXFELS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|