About ethane;2-ethyl-6-methylindazole
ethane;2-ethyl-6-methylindazole (PubChem CID 177232653) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is ethane;2-ethyl-6-methylindazole.
Molecular Properties
| Compound Name | ethane;2-ethyl-6-methylindazole |
| PubChem CID | 177232653 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | ethane;2-ethyl-6-methylindazole |
| SMILES | CC.CCn1cc2ccc(C)cc2n1 |
| InChI | InChI=1S/C10H12N2.C2H6/c1-3-12-7-9-5-4-8(2)6-10(9)11-12;1-2/h4-7H,3H2,1-2H3;1-2H3 |
| InChIKey | NGMBKLHSGVOAQJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-ethyl-6-methylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-6-methylindazole?
The IUPAC name of ethane;2-ethyl-6-methylindazole (CID 177232653) is ethane;2-ethyl-6-methylindazole.
What is the SMILES notation for ethane;2-ethyl-6-methylindazole?
The canonical SMILES for ethane;2-ethyl-6-methylindazole is CC.CCn1cc2ccc(C)cc2n1.
What is the InChIKey of ethane;2-ethyl-6-methylindazole?
The InChIKey is NGMBKLHSGVOAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2.C2H6/c1-3-12-7-9-5-4-8(2)6-10(9)11-12;1-2/h4-7H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;2-ethyl-6-methylindazole?
ethane;2-ethyl-6-methylindazole has a molecular weight of 190.29 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-6-methylindazole is sourced from PubChem (CID 177232653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).