C13H17B2N3 — CID 91311441
CID 91311441 (PubChem CID 91311441) has the molecular formula C13H17B2N3 and a molecular weight of 236.92 g/mol.
| Compound Name | CID 91311441 |
|---|---|
| PubChem CID | 91311441 |
| Molecular Formula | C13H17B2N3 |
| Molecular Weight | 236.92 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | — |
| SMILES | Cc1ccc2cn(CC3CCCN3)nc2c1.[B][B] |
| InChI | InChI=1S/C13H17N3.B2/c1-10-4-5-11-8-16(15-13(11)7-10)9-12-3-2-6-14-12;1-2/h4-5,7-8,12,14H,2-3,6,9H2,1H3; |
| InChIKey | HPEMQXQCCIRESD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.92 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|