C11H24O2 — CID 177233187
5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane;propane (PubChem CID 177233187) has the molecular formula C11H24O2 and a molecular weight of 188.31 g/mol. Its IUPAC name is 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane;propane.
| Compound Name | 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane;propane |
|---|---|
| PubChem CID | 177233187 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 5,6-dimethyl-2,3-dihydro-1,4-dioxine;ethane;propane |
| SMILES | CC.CC1=C(C)OCCO1.CCC |
| InChI | InChI=1S/C6H10O2.C3H8.C2H6/c1-5-6(2)8-4-3-7-5;1-3-2;1-2/h3-4H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | LLXHYMJYOJNMJN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |