C27H25F2N7O4S — CID 177234777
[N-[4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(4-formyl-8-oxo-4,7-diazaspiro[2.5]octan-7-yl)pyridine-3-carbonyl]carbamimidoyl] 3-cyclopropylprop-2-ynimidothioate (PubChem CID 177234777) has the molecular formula C27H25F2N7O4S and a molecular weight of 581.61 g/mol. Its IUPAC name is [N-[4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(4-formyl-8-oxo-4,7-diazaspiro[2.5]octan-7-yl)pyridine-3-carbonyl]carbamimidoyl] 3-cyclopropylprop-2-ynimidothioate.
| Compound Name | [N-[4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(4-formyl-8-oxo-4,7-diazaspiro[2.5]octan-7-yl)pyridine-3-carbonyl]carbamimidoyl] 3-cyclopropylprop-2-ynimidothioate |
|---|---|
| PubChem CID | 177234777 |
| Molecular Formula | C27H25F2N7O4S |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | [N-[4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(4-formyl-8-oxo-4,7-diazaspiro[2.5]octan-7-yl)pyridine-3-carbonyl]carbamimidoyl] 3-cyclopropylprop-2-ynimidothioate |
| SMILES | [H]/N=C(/NC(=O)c1cnc(N2CCN(C=O)C3(CC3)C2=O)cc1-c1cc(C(F)F)ncc1OC)S/C(C#CC1CC1)=N/[H] |
| InChI | InChI=1S/C27H25F2N7O4S/c1-40-20-13-32-19(23(28)29)10-17(20)16-11-22(36-9-8-35(14-37)27(6-7-27)25(36)39)33-12-18(16)24(38)34-26(31)41-21(30)5-4-15-2-3-15/h10-15,23,30H,2-3,6-9H2,1H3,(H2,31,34,38)/b30-21+ |
| InChIKey | WOFXGOPXQZPZSF-MWAVMZGNSA-N |
| XLogP | 3.22 |
| TPSA | 152.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|