C22H19F3N4O3S — CID 178081468
[N-[5-[2-methoxy-5-(trifluoromethyl)phenyl]-1-methyl-2-oxopyridine-4-carbonyl]carbamimidoyl] 3-cyclopropylprop-2-ynimidothioate (PubChem CID 178081468) has the molecular formula C22H19F3N4O3S and a molecular weight of 476.48 g/mol. Its IUPAC name is [N-[5-[2-methoxy-5-(trifluoromethyl)phenyl]-1-methyl-2-oxopyridine-4-carbonyl]carbamimidoyl] 3-cyclopropylprop-2-ynimidothioate.
| Compound Name | [N-[5-[2-methoxy-5-(trifluoromethyl)phenyl]-1-methyl-2-oxopyridine-4-carbonyl]carbamimidoyl] 3-cyclopropylprop-2-ynimidothioate |
|---|---|
| PubChem CID | 178081468 |
| Molecular Formula | C22H19F3N4O3S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | [N-[5-[2-methoxy-5-(trifluoromethyl)phenyl]-1-methyl-2-oxopyridine-4-carbonyl]carbamimidoyl] 3-cyclopropylprop-2-ynimidothioate |
| SMILES | [H]/N=C(/NC(=O)c1cc(=O)n(C)cc1-c1cc(C(F)(F)F)ccc1OC)S/C(C#CC1CC1)=N/[H] |
| InChI | InChI=1S/C22H19F3N4O3S/c1-29-11-16(14-9-13(22(23,24)25)6-7-17(14)32-2)15(10-19(29)30)20(31)28-21(27)33-18(26)8-5-12-3-4-12/h6-7,9-12,26H,3-4H2,1-2H3,(H2,27,28,31)/b26-18+ |
| InChIKey | WQCSWPPDFXLPCO-NLRVBDNBSA-N |
| XLogP | 3.87 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|