C26H23F3N6O3S — CID 177235357
1-[[4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(3-fluoro-2-oxo-1-pyridinyl)pyridine-3-carbonyl]amino]ethyl (1Z)-N-amino-3-cyclopropylprop-2-ynimidothioate (PubChem CID 177235357) has the molecular formula C26H23F3N6O3S and a molecular weight of 556.57 g/mol. Its IUPAC name is 1-[[4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(3-fluoro-2-oxo-1-pyridinyl)pyridine-3-carbonyl]amino]ethyl (1Z)-N-amino-3-cyclopropylprop-2-ynimidothioate.
| Compound Name | 1-[[4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(3-fluoro-2-oxo-1-pyridinyl)pyridine-3-carbonyl]amino]ethyl (1Z)-N-amino-3-cyclopropylprop-2-ynimidothioate |
|---|---|
| PubChem CID | 177235357 |
| Molecular Formula | C26H23F3N6O3S |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 1-[[4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(3-fluoro-2-oxo-1-pyridinyl)pyridine-3-carbonyl]amino]ethyl (1Z)-N-amino-3-cyclopropylprop-2-ynimidothioate |
| SMILES | COc1cnc(C(F)F)cc1-c1cc(-n2cccc(F)c2=O)ncc1C(=O)NC(C)S/C(C#CC1CC1)=N\N |
| InChI | InChI=1S/C26H23F3N6O3S/c1-14(39-23(34-30)8-7-15-5-6-15)33-25(36)18-12-32-22(35-9-3-4-19(27)26(35)37)11-16(18)17-10-20(24(28)29)31-13-21(17)38-2/h3-4,9-15,24H,5-6,30H2,1-2H3,(H,33,36)/b34-23- |
| InChIKey | FBSPTQGXGPTAAP-XSVYLIDLSA-N |
| XLogP | 3.87 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|