C16H20FNO — CID 177235551
3-fluoro-1-[(2E,6E)-5-methyldeca-2,4,6-trien-2-yl]pyridin-2-one (PubChem CID 177235551) has the molecular formula C16H20FNO and a molecular weight of 261.34 g/mol. Its IUPAC name is 3-fluoro-1-[(2E,6E)-5-methyldeca-2,4,6-trien-2-yl]pyridin-2-one.
| Compound Name | 3-fluoro-1-[(2E,6E)-5-methyldeca-2,4,6-trien-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 177235551 |
| Molecular Formula | C16H20FNO |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-fluoro-1-[(2E,6E)-5-methyldeca-2,4,6-trien-2-yl]pyridin-2-one |
| SMILES | CCC/C=C/C(C)=C/C=C(\C)n1cccc(F)c1=O |
| InChI | InChI=1S/C16H20FNO/c1-4-5-6-8-13(2)10-11-14(3)18-12-7-9-15(17)16(18)19/h6-12H,4-5H2,1-3H3/b8-6+,13-10?,14-11+ |
| InChIKey | LQYLXUWGCSXNAN-UXJUEDRXSA-N |
| XLogP | 4.15 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|