C11H13N — CID 177235689
(2Z)-2-hexa-3,4-dien-2-ylidene-1H-pyridine (PubChem CID 177235689) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is (2Z)-2-hexa-3,4-dien-2-ylidene-1H-pyridine.
| Compound Name | (2Z)-2-hexa-3,4-dien-2-ylidene-1H-pyridine |
|---|---|
| PubChem CID | 177235689 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (2Z)-2-hexa-3,4-dien-2-ylidene-1H-pyridine |
| SMILES | CC=C=C/C(C)=C1/C=CC=CN1 |
| InChI | InChI=1S/C11H13N/c1-3-4-7-10(2)11-8-5-6-9-12-11/h3,5-9,12H,1-2H3/b11-10- |
| InChIKey | PJHPLIQVJHAKJG-KHPPLWFESA-N |
| XLogP | 2.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |