C22H27NO2S — CID 163504702
ethyl (E,2E,5R)-4-methyl-5-phenyl-5-propan-2-ylsulfanyl-2-(1H-pyridin-2-ylidene)pent-3-enoate (PubChem CID 163504702) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is ethyl (E,2E,5R)-4-methyl-5-phenyl-5-propan-2-ylsulfanyl-2-(1H-pyridin-2-ylidene)pent-3-enoate.
| Compound Name | ethyl (E,2E,5R)-4-methyl-5-phenyl-5-propan-2-ylsulfanyl-2-(1H-pyridin-2-ylidene)pent-3-enoate |
|---|---|
| PubChem CID | 163504702 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | ethyl (E,2E,5R)-4-methyl-5-phenyl-5-propan-2-ylsulfanyl-2-(1H-pyridin-2-ylidene)pent-3-enoate |
| SMILES | CCOC(=O)C(/C=C(\C)[C@@H](SC(C)C)c1ccccc1)=C1\C=CC=CN1 |
| InChI | InChI=1S/C22H27NO2S/c1-5-25-22(24)19(20-13-9-10-14-23-20)15-17(4)21(26-16(2)3)18-11-7-6-8-12-18/h6-16,21,23H,5H2,1-4H3/b17-15+,20-19+/t21-/m1/s1 |
| InChIKey | CXPHANORAJZYLB-NGRQHIHJSA-N |
| XLogP | 5.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|