C17H16N2O5 — CID 177236760
ethyl 4-hydroxy-6-oxo-2-(2-phenyl-1,3-oxazol-4-yl)-2,3-dihydro-1H-pyridine-5-carboxylate (PubChem CID 177236760) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is ethyl 4-hydroxy-6-oxo-2-(2-phenyl-1,3-oxazol-4-yl)-2,3-dihydro-1H-pyridine-5-carboxylate.
| Compound Name | ethyl 4-hydroxy-6-oxo-2-(2-phenyl-1,3-oxazol-4-yl)-2,3-dihydro-1H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 177236760 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | ethyl 4-hydroxy-6-oxo-2-(2-phenyl-1,3-oxazol-4-yl)-2,3-dihydro-1H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(O)CC(c2coc(-c3ccccc3)n2)NC1=O |
| InChI | InChI=1S/C17H16N2O5/c1-2-23-17(22)14-13(20)8-11(18-15(14)21)12-9-24-16(19-12)10-6-4-3-5-7-10/h3-7,9,11,20H,2,8H2,1H3,(H,18,21) |
| InChIKey | WKIZPSNRXPTGAU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|