C12H12BrNO5 — CID 177236765
ethyl 2-(4-bromofuran-2-yl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate (PubChem CID 177236765) has the molecular formula C12H12BrNO5 and a molecular weight of 330.13 g/mol. Its IUPAC name is ethyl 2-(4-bromofuran-2-yl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate.
| Compound Name | ethyl 2-(4-bromofuran-2-yl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 177236765 |
| Molecular Formula | C12H12BrNO5 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | ethyl 2-(4-bromofuran-2-yl)-4-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(O)CC(c2cc(Br)co2)NC1=O |
| InChI | InChI=1S/C12H12BrNO5/c1-2-18-12(17)10-8(15)4-7(14-11(10)16)9-3-6(13)5-19-9/h3,5,7,15H,2,4H2,1H3,(H,14,16) |
| InChIKey | KHBQNWAZWPBROF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|