C25H18Cl3F2N3O4S — CID 177239119
3-(4-acetyl-2,3,6,8-tetrahydropyrrolo[3,4-g][1,4]benzoxazine-7-carbonyl)-6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-1H-pyridin-2-one (PubChem CID 177239119) has the molecular formula C25H18Cl3F2N3O4S and a molecular weight of 600.86 g/mol. Its IUPAC name is 3-(4-acetyl-2,3,6,8-tetrahydropyrrolo[3,4-g][1,4]benzoxazine-7-carbonyl)-6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-1H-pyridin-2-one.
| Compound Name | 3-(4-acetyl-2,3,6,8-tetrahydropyrrolo[3,4-g][1,4]benzoxazine-7-carbonyl)-6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 177239119 |
| Molecular Formula | C25H18Cl3F2N3O4S |
| Molecular Weight | 600.86 g/mol |
| Exact Mass | 599.01 |
| IUPAC Name | 3-(4-acetyl-2,3,6,8-tetrahydropyrrolo[3,4-g][1,4]benzoxazine-7-carbonyl)-6-[chloro(difluoro)methyl]-4-(2,6-dichlorophenyl)sulfanyl-1H-pyridin-2-one |
| SMILES | CC(=O)N1CCOc2cc3c(cc21)CN(C(=O)c1c(Sc2c(Cl)cccc2Cl)cc(C(F)(F)Cl)[nH]c1=O)C3 |
| InChI | InChI=1S/C25H18Cl3F2N3O4S/c1-12(34)33-5-6-37-18-8-14-11-32(10-13(14)7-17(18)33)24(36)21-19(9-20(25(28,29)30)31-23(21)35)38-22-15(26)3-2-4-16(22)27/h2-4,7-9H,5-6,10-11H2,1H3,(H,31,35) |
| InChIKey | KNABDLMYIRZCFB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.86 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|