C30H26N2O5S — CID 177245879
N-[3-[[4-(2-methoxyphenyl)benzoyl]amino]propyl]-1,1-dioxobenzo[f][1]benzothiole-2-carboxamide (PubChem CID 177245879) has the molecular formula C30H26N2O5S and a molecular weight of 526.61 g/mol. Its IUPAC name is N-[3-[[4-(2-methoxyphenyl)benzoyl]amino]propyl]-1,1-dioxobenzo[f][1]benzothiole-2-carboxamide.
| Compound Name | N-[3-[[4-(2-methoxyphenyl)benzoyl]amino]propyl]-1,1-dioxobenzo[f][1]benzothiole-2-carboxamide |
|---|---|
| PubChem CID | 177245879 |
| Molecular Formula | C30H26N2O5S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | N-[3-[[4-(2-methoxyphenyl)benzoyl]amino]propyl]-1,1-dioxobenzo[f][1]benzothiole-2-carboxamide |
| SMILES | COc1ccccc1-c1ccc(C(=O)NCCCNC(=O)C2=Cc3cc4ccccc4cc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C30H26N2O5S/c1-37-26-10-5-4-9-25(26)20-11-13-21(14-12-20)29(33)31-15-6-16-32-30(34)28-19-24-17-22-7-2-3-8-23(22)18-27(24)38(28,35)36/h2-5,7-14,17-19H,6,15-16H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | BWASBEXRDYDSIG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|