C25H21FN2O4S — CID 177245778
N-[3-[[4-(2-fluorophenyl)benzoyl]amino]propyl]-1,1-dioxo-1-benzothiophene-2-carboxamide (PubChem CID 177245778) has the molecular formula C25H21FN2O4S and a molecular weight of 464.52 g/mol. Its IUPAC name is N-[3-[[4-(2-fluorophenyl)benzoyl]amino]propyl]-1,1-dioxo-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-[[4-(2-fluorophenyl)benzoyl]amino]propyl]-1,1-dioxo-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 177245778 |
| Molecular Formula | C25H21FN2O4S |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | N-[3-[[4-(2-fluorophenyl)benzoyl]amino]propyl]-1,1-dioxo-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1ccc(-c2ccccc2F)cc1)C1=Cc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C25H21FN2O4S/c26-21-8-3-2-7-20(21)17-10-12-18(13-11-17)24(29)27-14-5-15-28-25(30)23-16-19-6-1-4-9-22(19)33(23,31)32/h1-4,6-13,16H,5,14-15H2,(H,27,29)(H,28,30) |
| InChIKey | INGHNSOFEBLVEC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|