C21H18N2O6S2 — CID 177245775
N-[3-[(1,1-dioxo-1-benzothiophene-2-carbonyl)amino]propyl]-1,1-dioxo-1-benzothiophene-2-carboxamide (PubChem CID 177245775) has the molecular formula C21H18N2O6S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is N-[3-[(1,1-dioxo-1-benzothiophene-2-carbonyl)amino]propyl]-1,1-dioxo-1-benzothiophene-2-carboxamide.
| Compound Name | N-[3-[(1,1-dioxo-1-benzothiophene-2-carbonyl)amino]propyl]-1,1-dioxo-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 177245775 |
| Molecular Formula | C21H18N2O6S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | N-[3-[(1,1-dioxo-1-benzothiophene-2-carbonyl)amino]propyl]-1,1-dioxo-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCCNC(=O)C1=Cc2ccccc2S1(=O)=O)C1=Cc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H18N2O6S2/c24-20(18-12-14-6-1-3-8-16(14)30(18,26)27)22-10-5-11-23-21(25)19-13-15-7-2-4-9-17(15)31(19,28)29/h1-4,6-9,12-13H,5,10-11H2,(H,22,24)(H,23,25) |
| InChIKey | PEUONRFKILJVQA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|