C13H25N3 — CID 177246443
4-(3,4-dimethylpyrazol-1-yl)-1-methylpiperidine;ethane (PubChem CID 177246443) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 4-(3,4-dimethylpyrazol-1-yl)-1-methylpiperidine;ethane.
| Compound Name | 4-(3,4-dimethylpyrazol-1-yl)-1-methylpiperidine;ethane |
|---|---|
| PubChem CID | 177246443 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 4-(3,4-dimethylpyrazol-1-yl)-1-methylpiperidine;ethane |
| SMILES | CC.Cc1cn(C2CCN(C)CC2)nc1C |
| InChI | InChI=1S/C11H19N3.C2H6/c1-9-8-14(12-10(9)2)11-4-6-13(3)7-5-11;1-2/h8,11H,4-7H2,1-3H3;1-2H3 |
| InChIKey | XEXRVFSWEUKLLU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |