C17H19N4O2+ — CID 177247454
[(Z)-1-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-pyridin-3-yl]amino]pent-3-en-2-ylidene]-ethenylideneazanium (PubChem CID 177247454) has the molecular formula C17H19N4O2+ and a molecular weight of 311.37 g/mol. Its IUPAC name is [(Z)-1-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-pyridin-3-yl]amino]pent-3-en-2-ylidene]-ethenylideneazanium.
| Compound Name | [(Z)-1-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-pyridin-3-yl]amino]pent-3-en-2-ylidene]-ethenylideneazanium |
|---|---|
| PubChem CID | 177247454 |
| Molecular Formula | C17H19N4O2+ |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [(Z)-1-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-pyridin-3-yl]amino]pent-3-en-2-ylidene]-ethenylideneazanium |
| SMILES | C=C=[N+]=C(/C=C\C)CNc1cc(-c2c(C)noc2C)c[nH]c1=O |
| InChI | InChI=1S/C17H18N4O2/c1-5-7-14(18-6-2)10-19-15-8-13(9-20-17(15)22)16-11(3)21-23-12(16)4/h5,7-9,19H,2,10H2,1,3-4H3/p+1/b7-5- |
| InChIKey | YMXYKUBUQQHPMF-ALCCZGGFSA-O |
| XLogP | 2.00 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|