C18H21N4O2+ — CID 177247086
5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[[(1R)-1-(1-methylpyridin-1-ium-2-yl)ethyl]amino]-1H-pyridin-2-one (PubChem CID 177247086) has the molecular formula C18H21N4O2+ and a molecular weight of 325.39 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[[(1R)-1-(1-methylpyridin-1-ium-2-yl)ethyl]amino]-1H-pyridin-2-one.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[[(1R)-1-(1-methylpyridin-1-ium-2-yl)ethyl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 177247086 |
| Molecular Formula | C18H21N4O2+ |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[[(1R)-1-(1-methylpyridin-1-ium-2-yl)ethyl]amino]-1H-pyridin-2-one |
| SMILES | Cc1noc(C)c1-c1c[nH]c(=O)c(N[C@H](C)c2cccc[n+]2C)c1 |
| InChI | InChI=1S/C18H20N4O2/c1-11(16-7-5-6-8-22(16)4)20-15-9-14(10-19-18(15)23)17-12(2)21-24-13(17)3/h5-11,20H,1-4H3/p+1/t11-/m1/s1 |
| InChIKey | VRIFRUAOXUQXAM-LLVKDONJSA-O |
| XLogP | 2.64 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|