C15H20O5 — CID 177248593
dimethyl 2-cyclohexyl-2H-pyran-3,5-dicarboxylate (PubChem CID 177248593) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is dimethyl 2-cyclohexyl-2H-pyran-3,5-dicarboxylate.
| Compound Name | dimethyl 2-cyclohexyl-2H-pyran-3,5-dicarboxylate |
|---|---|
| PubChem CID | 177248593 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | dimethyl 2-cyclohexyl-2H-pyran-3,5-dicarboxylate |
| SMILES | COC(=O)C1=COC(C2CCCCC2)C(C(=O)OC)=C1 |
| InChI | InChI=1S/C15H20O5/c1-18-14(16)11-8-12(15(17)19-2)13(20-9-11)10-6-4-3-5-7-10/h8-10,13H,3-7H2,1-2H3 |
| InChIKey | NVNLRVQKMAZUSF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |