C18H28O4 — CID 134956984
ethyl (2R,6S)-4-(cyclohexylmethoxy)-6-ethenyl-2-methyl-3,6-dihydro-2H-pyran-5-carboxylate (PubChem CID 134956984) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is ethyl (2R,6S)-4-(cyclohexylmethoxy)-6-ethenyl-2-methyl-3,6-dihydro-2H-pyran-5-carboxylate.
| Compound Name | ethyl (2R,6S)-4-(cyclohexylmethoxy)-6-ethenyl-2-methyl-3,6-dihydro-2H-pyran-5-carboxylate |
|---|---|
| PubChem CID | 134956984 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | ethyl (2R,6S)-4-(cyclohexylmethoxy)-6-ethenyl-2-methyl-3,6-dihydro-2H-pyran-5-carboxylate |
| SMILES | C=C[C@@H]1O[C@H](C)CC(OCC2CCCCC2)=C1C(=O)OCC |
| InChI | InChI=1S/C18H28O4/c1-4-15-17(18(19)20-5-2)16(11-13(3)22-15)21-12-14-9-7-6-8-10-14/h4,13-15H,1,5-12H2,2-3H3/t13-,15+/m1/s1 |
| InChIKey | GSFWQFHUNUNJQB-HIFRSBDPSA-N |
| XLogP | 3.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|