C13H17Br2NO5 — CID 177248911
2-(2-ethoxyethoxy)ethyl 2-[(5,6-dibromo-2-pyridinyl)oxy]acetate (PubChem CID 177248911) has the molecular formula C13H17Br2NO5 and a molecular weight of 427.09 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl 2-[(5,6-dibromo-2-pyridinyl)oxy]acetate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl 2-[(5,6-dibromo-2-pyridinyl)oxy]acetate |
|---|---|
| PubChem CID | 177248911 |
| Molecular Formula | C13H17Br2NO5 |
| Molecular Weight | 427.09 g/mol |
| Exact Mass | 424.95 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl 2-[(5,6-dibromo-2-pyridinyl)oxy]acetate |
| SMILES | CCOCCOCCOC(=O)COc1ccc(Br)c(Br)n1 |
| InChI | InChI=1S/C13H17Br2NO5/c1-2-18-5-6-19-7-8-20-12(17)9-21-11-4-3-10(14)13(15)16-11/h3-4H,2,5-9H2,1H3 |
| InChIKey | YVNSAACTFHQXTF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.09 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|