C34H30ClN5 — CID 177249061
N-[3-(3H-benzimidazol-1-ium-1-yl)phenyl]-9-(4-tert-butyl-2-pyridinyl)carbazol-2-amine chloride (PubChem CID 177249061) has the molecular formula C34H30ClN5 and a molecular weight of 544.10 g/mol. Its IUPAC name is N-[3-(3H-benzimidazol-1-ium-1-yl)phenyl]-9-(4-tert-butyl-2-pyridinyl)carbazol-2-amine chloride.
| Compound Name | N-[3-(3H-benzimidazol-1-ium-1-yl)phenyl]-9-(4-tert-butyl-2-pyridinyl)carbazol-2-amine chloride |
|---|---|
| PubChem CID | 177249061 |
| Molecular Formula | C34H30ClN5 |
| Molecular Weight | 544.10 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | N-[3-(3H-benzimidazol-1-ium-1-yl)phenyl]-9-(4-tert-butyl-2-pyridinyl)carbazol-2-amine chloride |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Nc4cccc(-[n+]5c[nH]c6ccccc65)c4)cc32)c1.[Cl-] |
| InChI | InChI=1S/C34H29N5.ClH/c1-34(2,3)23-17-18-35-33(19-23)39-30-13-6-4-11-27(30)28-16-15-25(21-32(28)39)37-24-9-8-10-26(20-24)38-22-36-29-12-5-7-14-31(29)38;/h4-22,37H,1-3H3;1H |
| InChIKey | ACYSZFUSNADAPI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.10 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|