C33H28N5O+ — CID 172634674
2-[3-(3H-benzimidazol-1-ium-1-yl)phenoxy]-9-(4-tert-butylpyrimidin-2-yl)carbazole (PubChem CID 172634674) has the molecular formula C33H28N5O+ and a molecular weight of 510.62 g/mol. Its IUPAC name is 2-[3-(3H-benzimidazol-1-ium-1-yl)phenoxy]-9-(4-tert-butylpyrimidin-2-yl)carbazole.
| Compound Name | 2-[3-(3H-benzimidazol-1-ium-1-yl)phenoxy]-9-(4-tert-butylpyrimidin-2-yl)carbazole |
|---|---|
| PubChem CID | 172634674 |
| Molecular Formula | C33H28N5O+ |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2-[3-(3H-benzimidazol-1-ium-1-yl)phenoxy]-9-(4-tert-butylpyrimidin-2-yl)carbazole |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4cccc(-[n+]5c[nH]c6ccccc65)c4)cc32)n1 |
| InChI | InChI=1S/C33H27N5O/c1-33(2,3)31-17-18-34-32(36-31)38-28-13-6-4-11-25(28)26-16-15-24(20-30(26)38)39-23-10-8-9-22(19-23)37-21-35-27-12-5-7-14-29(27)37/h4-21H,1-3H3/p+1 |
| InChIKey | NPRZVERCCUWGNI-UHFFFAOYSA-O |
| XLogP | 7.42 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|