C30H30N2O6 — CID 177249115
3,5-dimethoxy-2-[3-naphthalen-1-yl-2-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]phenol (PubChem CID 177249115) has the molecular formula C30H30N2O6 and a molecular weight of 514.58 g/mol. Its IUPAC name is 3,5-dimethoxy-2-[3-naphthalen-1-yl-2-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]phenol.
| Compound Name | 3,5-dimethoxy-2-[3-naphthalen-1-yl-2-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 177249115 |
| Molecular Formula | C30H30N2O6 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 3,5-dimethoxy-2-[3-naphthalen-1-yl-2-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]phenol |
| SMILES | COc1cc(O)c(C2=NN(c3cc(OC)c(OC)c(OC)c3)C(c3cccc4ccccc34)C2)c(OC)c1 |
| InChI | InChI=1S/C30H30N2O6/c1-34-20-15-25(33)29(26(16-20)35-2)23-17-24(22-12-8-10-18-9-6-7-11-21(18)22)32(31-23)19-13-27(36-3)30(38-5)28(14-19)37-4/h6-16,24,33H,17H2,1-5H3 |
| InChIKey | HVFRJLSFWDCNJV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|