C29H28N2O5 — CID 177249154
1-[3-(2-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]naphthalen-2-ol (PubChem CID 177249154) has the molecular formula C29H28N2O5 and a molecular weight of 484.55 g/mol. Its IUPAC name is 1-[3-(2-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]naphthalen-2-ol.
| Compound Name | 1-[3-(2-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]naphthalen-2-ol |
|---|---|
| PubChem CID | 177249154 |
| Molecular Formula | C29H28N2O5 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 1-[3-(2-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazol-5-yl]naphthalen-2-ol |
| SMILES | COc1ccccc1C1CC(c2c(O)ccc3ccccc23)=NN1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C29H28N2O5/c1-33-25-12-8-7-11-21(25)23-17-22(28-20-10-6-5-9-18(20)13-14-24(28)32)30-31(23)19-15-26(34-2)29(36-4)27(16-19)35-3/h5-16,23,32H,17H2,1-4H3 |
| InChIKey | AIFCZFSCAYZRJU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|