C24H27N3O4 — CID 177249845
4-methoxy-5-[(E)-2-methoxyethenyl]-N,N-bis[(4-methoxyphenyl)methyl]pyrimidin-2-amine (PubChem CID 177249845) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-methoxy-5-[(E)-2-methoxyethenyl]-N,N-bis[(4-methoxyphenyl)methyl]pyrimidin-2-amine.
| Compound Name | 4-methoxy-5-[(E)-2-methoxyethenyl]-N,N-bis[(4-methoxyphenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 177249845 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-methoxy-5-[(E)-2-methoxyethenyl]-N,N-bis[(4-methoxyphenyl)methyl]pyrimidin-2-amine |
| SMILES | CO/C=C/c1cnc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)nc1OC |
| InChI | InChI=1S/C24H27N3O4/c1-28-14-13-20-15-25-24(26-23(20)31-4)27(16-18-5-9-21(29-2)10-6-18)17-19-7-11-22(30-3)12-8-19/h5-15H,16-17H2,1-4H3/b14-13+ |
| InChIKey | BOCRYYMTYHWSQM-BUHFOSPRSA-N |
| XLogP | 4.33 |
| TPSA | 65.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|