C36H34N6O5S — CID 177251592
3,7-bis(1-methylindazol-5-yl)-10-(2-morpholin-4-ylethyl)phenothiazine-5,5-dicarboxylic acid (PubChem CID 177251592) has the molecular formula C36H34N6O5S and a molecular weight of 662.77 g/mol. Its IUPAC name is 3,7-bis(1-methylindazol-5-yl)-10-(2-morpholin-4-ylethyl)phenothiazine-5,5-dicarboxylic acid.
| Compound Name | 3,7-bis(1-methylindazol-5-yl)-10-(2-morpholin-4-ylethyl)phenothiazine-5,5-dicarboxylic acid |
|---|---|
| PubChem CID | 177251592 |
| Molecular Formula | C36H34N6O5S |
| Molecular Weight | 662.77 g/mol |
| Exact Mass | 662.23 |
| IUPAC Name | 3,7-bis(1-methylindazol-5-yl)-10-(2-morpholin-4-ylethyl)phenothiazine-5,5-dicarboxylic acid |
| SMILES | Cn1ncc2cc(-c3ccc4c(c3)S(C(=O)O)(C(=O)O)c3cc(-c5ccc6c(cnn6C)c5)ccc3N4CCN3CCOCC3)ccc21 |
| InChI | InChI=1S/C36H34N6O5S/c1-39-29-7-3-23(17-27(29)21-37-39)25-5-9-31-33(19-25)48(35(43)44,36(45)46)34-20-26(24-4-8-30-28(18-24)22-38-40(30)2)6-10-32(34)42(31)12-11-41-13-15-47-16-14-41/h3-10,17-22H,11-16H2,1-2H3,(H,43,44)(H,45,46) |
| InChIKey | QECSMVSJZJPDNR-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.77 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|