About CID 177262276
CID 177262276 (PubChem CID 177262276) has the molecular formula C10H21BO5
and a molecular weight of 232.08 g/mol.
Molecular Properties
| Compound Name | CID 177262276 |
| PubChem CID | 177262276 |
| Molecular Formula | C10H21BO5 |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | — |
| SMILES | [B]CCOCC(O)COCCC(O)COC |
| InChI | InChI=1S/C10H21BO5/c1-14-6-9(12)2-4-15-7-10(13)8-16-5-3-11/h9-10,12-13H,2-8H2,1H3 |
| InChIKey | SYROOEAOZUJNSN-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177262276 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177262276?
The IUPAC name of CID 177262276 (CID 177262276) is not available.
What is the SMILES notation for CID 177262276?
The canonical SMILES for CID 177262276 is [B]CCOCC(O)COCCC(O)COC.
What is the InChIKey of CID 177262276?
The InChIKey is SYROOEAOZUJNSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21BO5/c1-14-6-9(12)2-4-15-7-10(13)8-16-5-3-11/h9-10,12-13H,2-8H2,1H3.
What are the key properties of CID 177262276?
CID 177262276 has a molecular weight of 232.08 g/mol, XLogP of -0.64, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177262276 is sourced from PubChem (CID 177262276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).