C25H28N4O — CID 177268971
5-[3-(dimethylamino)azetidin-1-yl]-2-methyl-N-(1-quinolin-8-ylcyclopropyl)benzamide (PubChem CID 177268971) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 5-[3-(dimethylamino)azetidin-1-yl]-2-methyl-N-(1-quinolin-8-ylcyclopropyl)benzamide.
| Compound Name | 5-[3-(dimethylamino)azetidin-1-yl]-2-methyl-N-(1-quinolin-8-ylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 177268971 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 5-[3-(dimethylamino)azetidin-1-yl]-2-methyl-N-(1-quinolin-8-ylcyclopropyl)benzamide |
| SMILES | Cc1ccc(N2CC(N(C)C)C2)cc1C(=O)NC1(c2cccc3cccnc23)CC1 |
| InChI | InChI=1S/C25H28N4O/c1-17-9-10-19(29-15-20(16-29)28(2)3)14-21(17)24(30)27-25(11-12-25)22-8-4-6-18-7-5-13-26-23(18)22/h4-10,13-14,20H,11-12,15-16H2,1-3H3,(H,27,30) |
| InChIKey | WWKBHAYQKDMIDH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |