C46H26OS — CID 177271097
5-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-1-ylanthracen-9-yl)-3-oxa-20-thiapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene (PubChem CID 177271097) has the molecular formula C46H26OS and a molecular weight of 634.83 g/mol. Its IUPAC name is 5-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-1-ylanthracen-9-yl)-3-oxa-20-thiapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene.
| Compound Name | 5-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-1-ylanthracen-9-yl)-3-oxa-20-thiapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 177271097 |
| Molecular Formula | C46H26OS |
| Molecular Weight | 634.83 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | 5-(1,2,3,4,5,6,7,8-octadeuterio-10-phenanthren-1-ylanthracen-9-yl)-3-oxa-20-thiapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cccc4c3oc3c4ccc4c5ccccc5sc43)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3cccc4c3ccc3ccccc34)c2c1[2H] |
| InChI | InChI=1S/C46H26OS/c1-2-12-28-27(11-1)23-24-30-29(28)18-9-19-32(30)42-33-14-3-5-16-35(33)43(36-17-6-4-15-34(36)42)40-21-10-20-37-38-25-26-39-31-13-7-8-22-41(31)48-46(39)45(38)47-44(37)40/h1-26H/i3D,4D,5D,6D,14D,15D,16D,17D |
| InChIKey | ZTQNXGBCWQZZCH-CVIWLNIUSA-N |
| XLogP | 13.90 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.83 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|