About CID 177271355
CID 177271355 (PubChem CID 177271355) has the molecular formula C33H32IrN3O3-
and a molecular weight of 710.85 g/mol.
Molecular Properties
| Compound Name | CID 177271355 |
| PubChem CID | 177271355 |
| Molecular Formula | C33H32IrN3O3- |
| Molecular Weight | 710.85 g/mol |
| Exact Mass | 711.21 |
| IUPAC Name | — |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1ccc2ccc3oc4ccc5nc6ccnc7c1c2c3c4n5c67 |
| InChI | InChI=1S/C20H8N3O.C13H24O2.Ir/c1-2-10-4-5-13-17-16(10)11(3-1)18-19-12(8-9-21-18)22-15-7-6-14(24-13)20(17)23(15)19;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-2,4-9H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | AJTFEZHKHBLBKV-DZTQYQPZSA-N |
| XLogP | 8.63 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 710.85 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 177271355 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177271355?
The IUPAC name of CID 177271355 (CID 177271355) is not available.
What is the SMILES notation for CID 177271355?
The canonical SMILES for CID 177271355 is CCC(CC)C(=O)/C=C(\O)C(CC)CC.[Ir].[c-]1ccc2ccc3oc4ccc5nc6ccnc7c1c2c3c4n5c67.
What is the InChIKey of CID 177271355?
The InChIKey is AJTFEZHKHBLBKV-DZTQYQPZSA-N. The full InChI is InChI=1S/C20H8N3O.C13H24O2.Ir/c1-2-10-4-5-13-17-16(10)11(3-1)18-19-12(8-9-21-18)22-15-7-6-14(24-13)20(17)23(15)19;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h1-2,4-9H;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 177271355?
CID 177271355 has a molecular weight of 710.85 g/mol, XLogP of 8.63, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177271355 is sourced from PubChem (CID 177271355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).